C23H40N2O8 — CID 123700483
2-methylbutanenitrile;2-methylbutanoic acid;2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl 2-methylbutanoate (PubChem CID 123700483) has the molecular formula C23H40N2O8 and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-methylbutanenitrile;2-methylbutanoic acid;2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl 2-methylbutanoate.
| Compound Name | 2-methylbutanenitrile;2-methylbutanoic acid;2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 123700483 |
| Molecular Formula | C23H40N2O8 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 2-methylbutanenitrile;2-methylbutanoic acid;2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl 2-methylbutanoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCOC(=O)C(C)CC.CCC(C)C#N.CCC(C)C(=O)O |
| InChI | InChI=1S/C13H21NO6.C5H9N.C5H10O2/c1-4-10(3)12(16)19-8-9-20-13(17)14-6-7-18-11(15)5-2;1-3-5(2)4-6;1-3-4(2)5(6)7/h5,10H,2,4,6-9H2,1,3H3,(H,14,17);5H,3H2,1-2H3;4H,3H2,1-2H3,(H,6,7) |
| InChIKey | WWZRSAZCPLWWCK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 152.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|