C13H21NO7 — CID 59137886
2-[2-(2-oxopropanoyloxy)ethylcarbamoyloxy]ethyl 2-methylbutanoate (PubChem CID 59137886) has the molecular formula C13H21NO7 and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-[2-(2-oxopropanoyloxy)ethylcarbamoyloxy]ethyl 2-methylbutanoate.
| Compound Name | 2-[2-(2-oxopropanoyloxy)ethylcarbamoyloxy]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59137886 |
| Molecular Formula | C13H21NO7 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[2-(2-oxopropanoyloxy)ethylcarbamoyloxy]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOC(=O)NCCOC(=O)C(C)=O |
| InChI | InChI=1S/C13H21NO7/c1-4-9(2)11(16)20-7-8-21-13(18)14-5-6-19-12(17)10(3)15/h9H,4-8H2,1-3H3,(H,14,18) |
| InChIKey | UPSOTWNYUQVGLK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|