C28H19NO5 — CID 89114642
2-(2-octadeca-1,3,5,7,9,11,13,15,17-nonaynoxyethoxycarbonylamino)ethyl 2-methylbutanoate (PubChem CID 89114642) has the molecular formula C28H19NO5 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-(2-octadeca-1,3,5,7,9,11,13,15,17-nonaynoxyethoxycarbonylamino)ethyl 2-methylbutanoate.
| Compound Name | 2-(2-octadeca-1,3,5,7,9,11,13,15,17-nonaynoxyethoxycarbonylamino)ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 89114642 |
| Molecular Formula | C28H19NO5 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-(2-octadeca-1,3,5,7,9,11,13,15,17-nonaynoxyethoxycarbonylamino)ethyl 2-methylbutanoate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#COCCOC(=O)NCCOC(=O)C(C)CC |
| InChI | InChI=1S/C28H19NO5/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-32-24-25-34-28(31)29-21-23-33-27(30)26(3)5-2/h1,26H,5,21,23-25H2,2-3H3,(H,29,31) |
| InChIKey | CTTWIXAIGYIZGG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|