C44H50N6O9 — CID 59095543
octadeca-1,3,5,7,9,11,13,15,17-nonaynyl N-[5-[[6-(methoxycarbonylamino)hexyl-[6-(2-methoxyethoxycarbonylamino)hexylcarbamoyl]carbamoyl]amino]pentyl]carbamate (PubChem CID 59095543) has the molecular formula C44H50N6O9 and a molecular weight of 806.92 g/mol. Its IUPAC name is octadeca-1,3,5,7,9,11,13,15,17-nonaynyl N-[5-[[6-(methoxycarbonylamino)hexyl-[6-(2-methoxyethoxycarbonylamino)hexylcarbamoyl]carbamoyl]amino]pentyl]carbamate.
| Compound Name | octadeca-1,3,5,7,9,11,13,15,17-nonaynyl N-[5-[[6-(methoxycarbonylamino)hexyl-[6-(2-methoxyethoxycarbonylamino)hexylcarbamoyl]carbamoyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 59095543 |
| Molecular Formula | C44H50N6O9 |
| Molecular Weight | 806.92 g/mol |
| Exact Mass | 806.36 |
| IUPAC Name | octadeca-1,3,5,7,9,11,13,15,17-nonaynyl N-[5-[[6-(methoxycarbonylamino)hexyl-[6-(2-methoxyethoxycarbonylamino)hexylcarbamoyl]carbamoyl]amino]pentyl]carbamate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#COC(=O)NCCCCCNC(=O)N(CCCCCCNC(=O)OC)C(=O)NCCCCCCNC(=O)OCCOC |
| InChI | InChI=1S/C44H50N6O9/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-30-37-58-43(54)48-35-28-23-27-32-46-41(52)50(36-29-21-20-26-33-47-42(53)57-3)40(51)45-31-24-18-19-25-34-49-44(55)59-39-38-56-2/h1H,18-21,23-29,31-36,38-39H2,2-3H3,(H,45,51)(H,46,52)(H,47,53)(H,48,54)(H,49,55) |
| InChIKey | LHCSJUOXNUEMMJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 185.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.92 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|