C61H47N6O8Rf- — CID 59088274
[5-[[1,3-bis[6-(octadeca-1,3,5,7,9,11,13,15,17-nonaynoxycarbonylamino)hexylamino]-1,3-dioxopropan-2-yl]amino]pentylamino] propanoate;rutherfordium (PubChem CID 59088274) has the molecular formula C61H47N6O8Rf- and a molecular weight of 1259.08 g/mol. Its IUPAC name is [5-[[1,3-bis[6-(octadeca-1,3,5,7,9,11,13,15,17-nonaynoxycarbonylamino)hexylamino]-1,3-dioxopropan-2-yl]amino]pentylamino] propanoate;rutherfordium.
| Compound Name | [5-[[1,3-bis[6-(octadeca-1,3,5,7,9,11,13,15,17-nonaynoxycarbonylamino)hexylamino]-1,3-dioxopropan-2-yl]amino]pentylamino] propanoate;rutherfordium |
|---|---|
| PubChem CID | 59088274 |
| Molecular Formula | C61H47N6O8Rf- |
| Molecular Weight | 1259.08 g/mol |
| Exact Mass | 1258.47 |
| IUPAC Name | [5-[[1,3-bis[6-(octadeca-1,3,5,7,9,11,13,15,17-nonaynoxycarbonylamino)hexylamino]-1,3-dioxopropan-2-yl]amino]pentylamino] propanoate;rutherfordium |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#COC(=O)NCCCCCCNC(=O)C(NCCCCCNOC(=O)C[CH2-])C(=O)NCCCCCCNC(=O)OC#CC#CC#CC#CC#CC#CC#CC#CC#C.[Rf] |
| InChI | InChI=1S/C61H47N6O8.Rf/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-37-46-54-73-60(71)65-51-42-35-33-40-49-63-58(69)57(62-48-44-39-45-53-67-75-56(68)6-3)59(70)64-50-41-34-36-43-52-66-61(72)74-55-47-38-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2;/h1-2,57,62,67H,3,6,33-36,39-45,48-53H2,(H,63,69)(H,64,70)(H,65,71)(H,66,72);/q-1; |
| InChIKey | VBKISMFQNVITBW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 185.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1259.08 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|