About ethynyl N-dodecylcarbamate
ethynyl N-dodecylcarbamate (PubChem CID 163284724) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is ethynyl N-dodecylcarbamate.
Molecular Properties
| Compound Name | ethynyl N-dodecylcarbamate |
| PubChem CID | 163284724 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | ethynyl N-dodecylcarbamate |
| SMILES | C#COC(=O)NCCCCCCCCCCCC |
| InChI | InChI=1S/C15H27NO2/c1-3-5-6-7-8-9-10-11-12-13-14-16-15(17)18-4-2/h2H,3,5-14H2,1H3,(H,16,17) |
| InChIKey | GWZUFZHWVIAFPB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynyl N-dodecylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynyl N-dodecylcarbamate?
The IUPAC name of ethynyl N-dodecylcarbamate (CID 163284724) is ethynyl N-dodecylcarbamate.
What is the SMILES notation for ethynyl N-dodecylcarbamate?
The canonical SMILES for ethynyl N-dodecylcarbamate is C#COC(=O)NCCCCCCCCCCCC.
What is the InChIKey of ethynyl N-dodecylcarbamate?
The InChIKey is GWZUFZHWVIAFPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-3-5-6-7-8-9-10-11-12-13-14-16-15(17)18-4-2/h2H,3,5-14H2,1H3,(H,16,17).
What are the key properties of ethynyl N-dodecylcarbamate?
ethynyl N-dodecylcarbamate has a molecular weight of 253.39 g/mol, XLogP of 4.22, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethynyl N-dodecylcarbamate is sourced from PubChem (CID 163284724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).