About 3-iodoprop-1-ynyl N-hexylcarbamate
3-iodoprop-1-ynyl N-hexylcarbamate (PubChem CID 142657614) has the molecular formula C10H16INO2
and a molecular weight of 309.15 g/mol. Its IUPAC name is 3-iodoprop-1-ynyl N-hexylcarbamate.
Molecular Properties
| Compound Name | 3-iodoprop-1-ynyl N-hexylcarbamate |
| PubChem CID | 142657614 |
| Molecular Formula | C10H16INO2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 3-iodoprop-1-ynyl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OC#CCI |
| InChI | InChI=1S/C10H16INO2/c1-2-3-4-5-8-12-10(13)14-9-6-7-11/h2-5,7-8H2,1H3,(H,12,13) |
| InChIKey | VHMIBSVBNOONIQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoprop-1-ynyl N-hexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoprop-1-ynyl N-hexylcarbamate?
The IUPAC name of 3-iodoprop-1-ynyl N-hexylcarbamate (CID 142657614) is 3-iodoprop-1-ynyl N-hexylcarbamate.
What is the SMILES notation for 3-iodoprop-1-ynyl N-hexylcarbamate?
The canonical SMILES for 3-iodoprop-1-ynyl N-hexylcarbamate is CCCCCCNC(=O)OC#CCI.
What is the InChIKey of 3-iodoprop-1-ynyl N-hexylcarbamate?
The InChIKey is VHMIBSVBNOONIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16INO2/c1-2-3-4-5-8-12-10(13)14-9-6-7-11/h2-5,7-8H2,1H3,(H,12,13).
What are the key properties of 3-iodoprop-1-ynyl N-hexylcarbamate?
3-iodoprop-1-ynyl N-hexylcarbamate has a molecular weight of 309.15 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoprop-1-ynyl N-hexylcarbamate is sourced from PubChem (CID 142657614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).