About prop-1-ynyl N-butylcarbamate
prop-1-ynyl N-butylcarbamate (PubChem CID 22253646) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is prop-1-ynyl N-butylcarbamate.
Molecular Properties
| Compound Name | prop-1-ynyl N-butylcarbamate |
| PubChem CID | 22253646 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | prop-1-ynyl N-butylcarbamate |
| SMILES | CC#COC(=O)NCCCC |
| InChI | InChI=1S/C8H13NO2/c1-3-5-6-9-8(10)11-7-4-2/h3,5-6H2,1-2H3,(H,9,10) |
| InChIKey | NLGPPMLLUZWGGS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ynyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ynyl N-butylcarbamate?
The IUPAC name of prop-1-ynyl N-butylcarbamate (CID 22253646) is prop-1-ynyl N-butylcarbamate.
What is the SMILES notation for prop-1-ynyl N-butylcarbamate?
The canonical SMILES for prop-1-ynyl N-butylcarbamate is CC#COC(=O)NCCCC.
What is the InChIKey of prop-1-ynyl N-butylcarbamate?
The InChIKey is NLGPPMLLUZWGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-3-5-6-9-8(10)11-7-4-2/h3,5-6H2,1-2H3,(H,9,10).
What are the key properties of prop-1-ynyl N-butylcarbamate?
prop-1-ynyl N-butylcarbamate has a molecular weight of 155.20 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ynyl N-butylcarbamate is sourced from PubChem (CID 22253646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).