About prop-1-ene;prop-1-ynyl N-butylcarbamate
prop-1-ene;prop-1-ynyl N-butylcarbamate (PubChem CID 159252894) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is prop-1-ene;prop-1-ynyl N-butylcarbamate.
Molecular Properties
| Compound Name | prop-1-ene;prop-1-ynyl N-butylcarbamate |
| PubChem CID | 159252894 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | prop-1-ene;prop-1-ynyl N-butylcarbamate |
| SMILES | C=CC.CC#COC(=O)NCCCC |
| InChI | InChI=1S/C8H13NO2.C3H6/c1-3-5-6-9-8(10)11-7-4-2;1-3-2/h3,5-6H2,1-2H3,(H,9,10);3H,1H2,2H3 |
| InChIKey | KVNIVUNUGVLFAF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene;prop-1-ynyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene;prop-1-ynyl N-butylcarbamate?
The IUPAC name of prop-1-ene;prop-1-ynyl N-butylcarbamate (CID 159252894) is prop-1-ene;prop-1-ynyl N-butylcarbamate.
What is the SMILES notation for prop-1-ene;prop-1-ynyl N-butylcarbamate?
The canonical SMILES for prop-1-ene;prop-1-ynyl N-butylcarbamate is C=CC.CC#COC(=O)NCCCC.
What is the InChIKey of prop-1-ene;prop-1-ynyl N-butylcarbamate?
The InChIKey is KVNIVUNUGVLFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2.C3H6/c1-3-5-6-9-8(10)11-7-4-2;1-3-2/h3,5-6H2,1-2H3,(H,9,10);3H,1H2,2H3.
What are the key properties of prop-1-ene;prop-1-ynyl N-butylcarbamate?
prop-1-ene;prop-1-ynyl N-butylcarbamate has a molecular weight of 197.28 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene;prop-1-ynyl N-butylcarbamate is sourced from PubChem (CID 159252894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).