C15H32N2O2 — CID 158116077
N-methylpentan-1-amine;prop-2-enyl N-pentylcarbamate (PubChem CID 158116077) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is N-methylpentan-1-amine;prop-2-enyl N-pentylcarbamate.
| Compound Name | N-methylpentan-1-amine;prop-2-enyl N-pentylcarbamate |
|---|---|
| PubChem CID | 158116077 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | N-methylpentan-1-amine;prop-2-enyl N-pentylcarbamate |
| SMILES | C=CCOC(=O)NCCCCC.CCCCCNC |
| InChI | InChI=1S/C9H17NO2.C6H15N/c1-3-5-6-7-10-9(11)12-8-4-2;1-3-4-5-6-7-2/h4H,2-3,5-8H2,1H3,(H,10,11);7H,3-6H2,1-2H3 |
| InChIKey | FRABXJXZMZEADC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|