C13H24N2O4 — CID 89280805
prop-2-enyl N-[4-[(2-propan-2-yloxyacetyl)amino]butyl]carbamate (PubChem CID 89280805) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is prop-2-enyl N-[4-[(2-propan-2-yloxyacetyl)amino]butyl]carbamate.
| Compound Name | prop-2-enyl N-[4-[(2-propan-2-yloxyacetyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 89280805 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | prop-2-enyl N-[4-[(2-propan-2-yloxyacetyl)amino]butyl]carbamate |
| SMILES | C=CCOC(=O)NCCCCNC(=O)COC(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-4-9-18-13(17)15-8-6-5-7-14-12(16)10-19-11(2)3/h4,11H,1,5-10H2,2-3H3,(H,14,16)(H,15,17) |
| InChIKey | PVQBISMSCXOLPH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|