C9H15BrN2O3 — CID 140660586
prop-2-enyl N-[3-[(2-bromoacetyl)amino]propyl]carbamate (PubChem CID 140660586) has the molecular formula C9H15BrN2O3 and a molecular weight of 279.13 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(2-bromoacetyl)amino]propyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(2-bromoacetyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 140660586 |
| Molecular Formula | C9H15BrN2O3 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | prop-2-enyl N-[3-[(2-bromoacetyl)amino]propyl]carbamate |
| SMILES | C=CCOC(=O)NCCCNC(=O)CBr |
| InChI | InChI=1S/C9H15BrN2O3/c1-2-6-15-9(14)12-5-3-4-11-8(13)7-10/h2H,1,3-7H2,(H,11,13)(H,12,14) |
| InChIKey | DTCNYCOQAYKQCP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|