C21H30N4O6 — CID 102048197
3,5-bis[3-(prop-2-enoxycarbonylamino)propylamino]benzoic acid (PubChem CID 102048197) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 3,5-bis[3-(prop-2-enoxycarbonylamino)propylamino]benzoic acid.
| Compound Name | 3,5-bis[3-(prop-2-enoxycarbonylamino)propylamino]benzoic acid |
|---|---|
| PubChem CID | 102048197 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 3,5-bis[3-(prop-2-enoxycarbonylamino)propylamino]benzoic acid |
| SMILES | C=CCOC(=O)NCCCNc1cc(NCCCNC(=O)OCC=C)cc(C(=O)O)c1 |
| InChI | InChI=1S/C21H30N4O6/c1-3-11-30-20(28)24-9-5-7-22-17-13-16(19(26)27)14-18(15-17)23-8-6-10-25-21(29)31-12-4-2/h3-4,13-15,22-23H,1-2,5-12H2,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | STIKALCWCLIUMN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|