C37H54N4O12 — CID 102170269
3,5-bis[3-[(2-oxo-2-prop-2-enoxyethyl)-[3-(prop-2-enoxycarbonylamino)propyl]amino]propoxy]benzoic acid (PubChem CID 102170269) has the molecular formula C37H54N4O12 and a molecular weight of 746.86 g/mol. Its IUPAC name is 3,5-bis[3-[(2-oxo-2-prop-2-enoxyethyl)-[3-(prop-2-enoxycarbonylamino)propyl]amino]propoxy]benzoic acid.
| Compound Name | 3,5-bis[3-[(2-oxo-2-prop-2-enoxyethyl)-[3-(prop-2-enoxycarbonylamino)propyl]amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 102170269 |
| Molecular Formula | C37H54N4O12 |
| Molecular Weight | 746.86 g/mol |
| Exact Mass | 746.37 |
| IUPAC Name | 3,5-bis[3-[(2-oxo-2-prop-2-enoxyethyl)-[3-(prop-2-enoxycarbonylamino)propyl]amino]propoxy]benzoic acid |
| SMILES | C=CCOC(=O)CN(CCCNC(=O)OCC=C)CCCOc1cc(OCCCN(CCCNC(=O)OCC=C)CC(=O)OCC=C)cc(C(=O)O)c1 |
| InChI | InChI=1S/C37H54N4O12/c1-5-19-50-33(42)28-40(15-9-13-38-36(46)52-21-7-3)17-11-23-48-31-25-30(35(44)45)26-32(27-31)49-24-12-18-41(29-34(43)51-20-6-2)16-10-14-39-37(47)53-22-8-4/h5-8,25-27H,1-4,9-24,28-29H2,(H,38,46)(H,39,47)(H,44,45) |
| InChIKey | DYPAPWJTGZALNI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 191.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|