C13H14O4 — CID 3313564
3,5-bis(prop-2-enoxy)benzoic acid (PubChem CID 3313564) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3,5-bis(prop-2-enoxy)benzoic acid.
| Compound Name | 3,5-bis(prop-2-enoxy)benzoic acid |
|---|---|
| PubChem CID | 3313564 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3,5-bis(prop-2-enoxy)benzoic acid |
| SMILES | C=CCOc1cc(OCC=C)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H14O4/c1-3-5-16-11-7-10(13(14)15)8-12(9-11)17-6-4-2/h3-4,7-9H,1-2,5-6H2,(H,14,15) |
| InChIKey | DYXSRNKEBQTTIB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|