C14H16O4 — CID 68685212
3-methoxy-4-prop-2-enoxy-5-prop-2-enylbenzoic acid (PubChem CID 68685212) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-methoxy-4-prop-2-enoxy-5-prop-2-enylbenzoic acid.
| Compound Name | 3-methoxy-4-prop-2-enoxy-5-prop-2-enylbenzoic acid |
|---|---|
| PubChem CID | 68685212 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-methoxy-4-prop-2-enoxy-5-prop-2-enylbenzoic acid |
| SMILES | C=CCOc1c(CC=C)cc(C(=O)O)cc1OC |
| InChI | InChI=1S/C14H16O4/c1-4-6-10-8-11(14(15)16)9-12(17-3)13(10)18-7-5-2/h4-5,8-9H,1-2,6-7H2,3H3,(H,15,16) |
| InChIKey | FRRMZWYWQVCYCV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|