C14H17NO3 — CID 126079797
(NZ)-N-[(3-methoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylidene]hydroxylamine (PubChem CID 126079797) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (NZ)-N-[(3-methoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(3-methoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 126079797 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (NZ)-N-[(3-methoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylidene]hydroxylamine |
| SMILES | C=CCOc1c(CC=C)cc(/C=N\O)cc1OC |
| InChI | InChI=1S/C14H17NO3/c1-4-6-12-8-11(10-15-16)9-13(17-3)14(12)18-7-5-2/h4-5,8-10,16H,1-2,6-7H2,3H3/b15-10- |
| InChIKey | MYNRLZFWDCGIDD-GDNBJRDFSA-N |
| XLogP | 2.80 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|