C13H17NO3 — CID 126075385
(NZ)-N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methylidene]hydroxylamine (PubChem CID 126075385) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (NZ)-N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 126075385 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (NZ)-N-[(4-ethoxy-3-methoxy-5-prop-2-enylphenyl)methylidene]hydroxylamine |
| SMILES | C=CCc1cc(/C=N\O)cc(OC)c1OCC |
| InChI | InChI=1S/C13H17NO3/c1-4-6-11-7-10(9-14-15)8-12(16-3)13(11)17-5-2/h4,7-9,15H,1,5-6H2,2-3H3/b14-9- |
| InChIKey | UCWCJNJSBHNWGT-ZROIWOOFSA-N |
| XLogP | 2.63 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|