C16H21N3O3 — CID 168532862
[(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylideneamino]urea (PubChem CID 168532862) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is [(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylideneamino]urea.
| Compound Name | [(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 168532862 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | [(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)methylideneamino]urea |
| SMILES | C=CCOc1c(CC=C)cc(C=NNC(N)=O)cc1OCC |
| InChI | InChI=1S/C16H21N3O3/c1-4-7-13-9-12(11-18-19-16(17)20)10-14(21-6-3)15(13)22-8-5-2/h4-5,9-11H,1-2,6-8H2,3H3,(H3,17,19,20) |
| InChIKey | SKOZXFKRWNUNJW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|