C9H10INO3 — CID 5407943
(NZ)-N-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydroxylamine (PubChem CID 5407943) has the molecular formula C9H10INO3 and a molecular weight of 307.09 g/mol. Its IUPAC name is (NZ)-N-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 5407943 |
| Molecular Formula | C9H10INO3 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | (NZ)-N-[(3-iodo-4,5-dimethoxyphenyl)methylidene]hydroxylamine |
| SMILES | COc1cc(/C=N\O)cc(I)c1OC |
| InChI | InChI=1S/C9H10INO3/c1-13-8-4-6(5-11-12)3-7(10)9(8)14-2/h3-5,12H,1-2H3/b11-5- |
| InChIKey | XWSRLDIBKGPNKA-WZUFQYTHSA-N |
| XLogP | 2.12 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|