C10H13NO2 — CID 87388843
(NZ)-N-[(4-methoxy-3,5-dimethylphenyl)methylidene]hydroxylamine (PubChem CID 87388843) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (NZ)-N-[(4-methoxy-3,5-dimethylphenyl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4-methoxy-3,5-dimethylphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 87388843 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (NZ)-N-[(4-methoxy-3,5-dimethylphenyl)methylidene]hydroxylamine |
| SMILES | COc1c(C)cc(/C=N\O)cc1C |
| InChI | InChI=1S/C10H13NO2/c1-7-4-9(6-11-12)5-8(2)10(7)13-3/h4-6,12H,1-3H3/b11-6- |
| InChIKey | SZDBIYZPTNPKJD-WDZFZDKYSA-N |
| XLogP | 2.12 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|