C11H15NO2 — CID 56607063
N-[1-(4-methoxy-3,5-dimethylphenyl)ethylidene]hydroxylamine (PubChem CID 56607063) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-[1-(4-methoxy-3,5-dimethylphenyl)ethylidene]hydroxylamine.
| Compound Name | N-[1-(4-methoxy-3,5-dimethylphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 56607063 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-[1-(4-methoxy-3,5-dimethylphenyl)ethylidene]hydroxylamine |
| SMILES | COc1c(C)cc(C(C)=NO)cc1C |
| InChI | InChI=1S/C11H15NO2/c1-7-5-10(9(3)12-13)6-8(2)11(7)14-4/h5-6,13H,1-4H3 |
| InChIKey | ZUQATXUULLFQLL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|