C10H12O2S — CID 116918890
4-methoxy-3,5-dimethylbenzenecarbothioic S-acid (PubChem CID 116918890) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethylbenzenecarbothioic S-acid.
| Compound Name | 4-methoxy-3,5-dimethylbenzenecarbothioic S-acid |
|---|---|
| PubChem CID | 116918890 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 4-methoxy-3,5-dimethylbenzenecarbothioic S-acid |
| SMILES | COc1c(C)cc(C(=O)S)cc1C |
| InChI | InChI=1S/C10H12O2S/c1-6-4-8(10(11)13)5-7(2)9(6)12-3/h4-5H,1-3H3,(H,11,13) |
| InChIKey | VJHZICTVCNABIP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|