C9H12O2 — CID 643378
4-methoxy-3,5-dimethylphenol (PubChem CID 643378) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethylphenol.
| Compound Name | 4-methoxy-3,5-dimethylphenol |
|---|---|
| PubChem CID | 643378 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-methoxy-3,5-dimethylphenol |
| SMILES | COc1c(C)cc(O)cc1C |
| InChI | InChI=1S/C9H12O2/c1-6-4-8(10)5-7(2)9(6)11-3/h4-5,10H,1-3H3 |
| InChIKey | OLIKAMRJNPUECN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |