C10H14IO+ — CID 22251529
(4-methoxy-3,5-dimethylphenyl)-methyliodanium (PubChem CID 22251529) has the molecular formula C10H14IO+ and a molecular weight of 277.12 g/mol. Its IUPAC name is (4-methoxy-3,5-dimethylphenyl)-methyliodanium.
| Compound Name | (4-methoxy-3,5-dimethylphenyl)-methyliodanium |
|---|---|
| PubChem CID | 22251529 |
| Molecular Formula | C10H14IO+ |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | (4-methoxy-3,5-dimethylphenyl)-methyliodanium |
| SMILES | COc1c(C)cc([I+]C)cc1C |
| InChI | InChI=1S/C10H14IO/c1-7-5-9(11-3)6-8(2)10(7)12-4/h5-6H,1-4H3/q+1 |
| InChIKey | LKXYZCVVORKWJT-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|