C20H34OSi — CID 72502399
(2-methoxy-3,5-dimethylphenyl)-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane (PubChem CID 72502399) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is (2-methoxy-3,5-dimethylphenyl)-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane.
| Compound Name | (2-methoxy-3,5-dimethylphenyl)-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane |
|---|---|
| PubChem CID | 72502399 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (2-methoxy-3,5-dimethylphenyl)-dimethyl-(2,3,4,5-tetramethylcyclopentyl)silane |
| SMILES | COc1c(C)cc(C)cc1[Si](C)(C)C1C(C)C(C)C(C)C1C |
| InChI | InChI=1S/C20H34OSi/c1-12-10-13(2)19(21-7)18(11-12)22(8,9)20-16(5)14(3)15(4)17(20)6/h10-11,14-17,20H,1-9H3 |
| InChIKey | SFLCBADBGMBYHT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|