C19H32BrNSi — CID 162299094
2-bromo-N-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]-4,6-dimethylaniline (PubChem CID 162299094) has the molecular formula C19H32BrNSi and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-bromo-N-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]-4,6-dimethylaniline.
| Compound Name | 2-bromo-N-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]-4,6-dimethylaniline |
|---|---|
| PubChem CID | 162299094 |
| Molecular Formula | C19H32BrNSi |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-bromo-N-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N[Si](C)(C)C2C(C)C(C)C(C)C2C)c(Br)c1 |
| InChI | InChI=1S/C19H32BrNSi/c1-11-9-12(2)18(17(20)10-11)21-22(7,8)19-15(5)13(3)14(4)16(19)6/h9-10,13-16,19,21H,1-8H3 |
| InChIKey | CJUNRSDMRPGSAD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|