C13H14BrNS — CID 101490319
4-bromo-N-(2,4,6-trimethylphenyl)thiophen-3-amine (PubChem CID 101490319) has the molecular formula C13H14BrNS and a molecular weight of 296.23 g/mol. Its IUPAC name is 4-bromo-N-(2,4,6-trimethylphenyl)thiophen-3-amine.
| Compound Name | 4-bromo-N-(2,4,6-trimethylphenyl)thiophen-3-amine |
|---|---|
| PubChem CID | 101490319 |
| Molecular Formula | C13H14BrNS |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 4-bromo-N-(2,4,6-trimethylphenyl)thiophen-3-amine |
| SMILES | Cc1cc(C)c(Nc2cscc2Br)c(C)c1 |
| InChI | InChI=1S/C13H14BrNS/c1-8-4-9(2)13(10(3)5-8)15-12-7-16-6-11(12)14/h4-7,15H,1-3H3 |
| InChIKey | CBVQAZJFXDKUJN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |