C72H78N6 — CID 122204956
2-N,3-N,6-N,7-N,10-N,11-N-hexakis(2,4,6-trimethylphenyl)triphenylene-2,3,6,7,10,11-hexamine (PubChem CID 122204956) has the molecular formula C72H78N6 and a molecular weight of 1027.46 g/mol. Its IUPAC name is 2-N,3-N,6-N,7-N,10-N,11-N-hexakis(2,4,6-trimethylphenyl)triphenylene-2,3,6,7,10,11-hexamine.
| Compound Name | 2-N,3-N,6-N,7-N,10-N,11-N-hexakis(2,4,6-trimethylphenyl)triphenylene-2,3,6,7,10,11-hexamine |
|---|---|
| PubChem CID | 122204956 |
| Molecular Formula | C72H78N6 |
| Molecular Weight | 1027.46 g/mol |
| Exact Mass | 1026.63 |
| IUPAC Name | 2-N,3-N,6-N,7-N,10-N,11-N-hexakis(2,4,6-trimethylphenyl)triphenylene-2,3,6,7,10,11-hexamine |
| SMILES | Cc1cc(C)c(Nc2cc3c4cc(Nc5c(C)cc(C)cc5C)c(Nc5c(C)cc(C)cc5C)cc4c4cc(Nc5c(C)cc(C)cc5C)c(Nc5c(C)cc(C)cc5C)cc4c3cc2Nc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C72H78N6/c1-37-19-43(7)67(44(8)20-37)73-61-31-55-56(32-62(61)74-68-45(9)21-38(2)22-46(68)10)58-34-64(76-70-49(13)25-40(4)26-50(70)14)66(78-72-53(17)29-42(6)30-54(72)18)36-60(58)59-35-65(77-71-51(15)27-41(5)28-52(71)16)63(33-57(55)59)75-69-47(11)23-39(3)24-48(69)12/h19-36,73-78H,1-18H3 |
| InChIKey | SLRYTYCTBBIACK-UHFFFAOYSA-N |
| XLogP | 21.16 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.46 |
| LogP ≤ 5 | 21.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|