C34H38N2 — CID 138453906
5-N,11-N-bis(2,4,6-trimethylphenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-diamine (PubChem CID 138453906) has the molecular formula C34H38N2 and a molecular weight of 474.69 g/mol. Its IUPAC name is 5-N,11-N-bis(2,4,6-trimethylphenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-diamine.
| Compound Name | 5-N,11-N-bis(2,4,6-trimethylphenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-diamine |
|---|---|
| PubChem CID | 138453906 |
| Molecular Formula | C34H38N2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 5-N,11-N-bis(2,4,6-trimethylphenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,11-diamine |
| SMILES | Cc1cc(C)c(Nc2cc3ccc2CCc2ccc(c(Nc4c(C)cc(C)cc4C)c2)CC3)c(C)c1 |
| InChI | InChI=1S/C34H38N2/c1-21-15-23(3)33(24(4)16-21)35-31-19-27-7-11-29(31)13-9-28-8-12-30(14-10-27)32(20-28)36-34-25(5)17-22(2)18-26(34)6/h7-8,11-12,15-20,35-36H,9-10,13-14H2,1-6H3 |
| InChIKey | CNYUFLBKAKUJAZ-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |