C49H52P2 — CID 134991120
(2,4-dimethylphenyl)-(3,5-dimethylphenyl)-[11-[(3,5-dimethylphenyl)-(3,4,5-trimethylphenyl)phosphanyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phosphane (PubChem CID 134991120) has the molecular formula C49H52P2 and a molecular weight of 702.90 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-(3,5-dimethylphenyl)-[11-[(3,5-dimethylphenyl)-(3,4,5-trimethylphenyl)phosphanyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phosphane.
| Compound Name | (2,4-dimethylphenyl)-(3,5-dimethylphenyl)-[11-[(3,5-dimethylphenyl)-(3,4,5-trimethylphenyl)phosphanyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phosphane |
|---|---|
| PubChem CID | 134991120 |
| Molecular Formula | C49H52P2 |
| Molecular Weight | 702.90 g/mol |
| Exact Mass | 702.35 |
| IUPAC Name | (2,4-dimethylphenyl)-(3,5-dimethylphenyl)-[11-[(3,5-dimethylphenyl)-(3,4,5-trimethylphenyl)phosphanyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)c(C)c(C)c2)c2cc3ccc2CCc2ccc(c(P(c4cc(C)cc(C)c4)c4ccc(C)cc4C)c2)CC3)c1 |
| InChI | InChI=1S/C49H52P2/c1-31-10-19-47(38(8)22-31)51(45-25-34(4)21-35(5)26-45)49-30-41-12-16-42-15-11-40(13-17-43(49)18-14-41)29-48(42)50(44-23-32(2)20-33(3)24-44)46-27-36(6)39(9)37(7)28-46/h10-11,14-15,18-30H,12-13,16-17H2,1-9H3 |
| InChIKey | DSQMHXQNNAESFT-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.90 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|