About 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane
3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane (PubChem CID 144671945) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane.
Analyze 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane?
The IUPAC name of 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane (CID 144671945) is 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane.
What is the SMILES notation for 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane?
The canonical SMILES for 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane is C.CC.CC1=Cc2ccc(C)cc2CC1.
What is the InChIKey of 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane?
The InChIKey is KZVLKOBQQQRODM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14.C2H6.CH4/c1-9-3-5-12-8-10(2)4-6-11(12)7-9;1-2;/h3,5,7-8H,4,6H2,1-2H3;1-2H3;1H4.
What are the key properties of 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane?
3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane has a molecular weight of 204.36 g/mol, XLogP of 5.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-1,2-dihydronaphthalene;ethane;methane is sourced from PubChem (CID 144671945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).