C13H16O2 — CID 10703379
6,7-dimethoxy-3-methyl-1,2-dihydronaphthalene (PubChem CID 10703379) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 6,7-dimethoxy-3-methyl-1,2-dihydronaphthalene.
| Compound Name | 6,7-dimethoxy-3-methyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 10703379 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 6,7-dimethoxy-3-methyl-1,2-dihydronaphthalene |
| SMILES | COc1cc2c(cc1OC)CCC(C)=C2 |
| InChI | InChI=1S/C13H16O2/c1-9-4-5-10-7-12(14-2)13(15-3)8-11(10)6-9/h6-8H,4-5H2,1-3H3 |
| InChIKey | AZPWKHKZDLLCBR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |