C20H25NO3 — CID 75243230
3-(6,7-dimethoxy-3,4-dihydronaphthalen-2-yl)-1-piperidin-1-ylprop-2-en-1-one (PubChem CID 75243230) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-3,4-dihydronaphthalen-2-yl)-1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | 3-(6,7-dimethoxy-3,4-dihydronaphthalen-2-yl)-1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 75243230 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3-(6,7-dimethoxy-3,4-dihydronaphthalen-2-yl)-1-piperidin-1-ylprop-2-en-1-one |
| SMILES | COc1cc2c(cc1OC)CCC(C=CC(=O)N1CCCCC1)=C2 |
| InChI | InChI=1S/C20H25NO3/c1-23-18-13-16-8-6-15(12-17(16)14-19(18)24-2)7-9-20(22)21-10-4-3-5-11-21/h7,9,12-14H,3-6,8,10-11H2,1-2H3 |
| InChIKey | WAQIPRQDUBHCAW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|