C19H25NO3 — CID 68980877
N-butyl-3-(6,7-dimethoxy-3,4-dihydronaphthalen-2-yl)prop-2-enamide (PubChem CID 68980877) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-butyl-3-(6,7-dimethoxy-3,4-dihydronaphthalen-2-yl)prop-2-enamide.
| Compound Name | N-butyl-3-(6,7-dimethoxy-3,4-dihydronaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 68980877 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-butyl-3-(6,7-dimethoxy-3,4-dihydronaphthalen-2-yl)prop-2-enamide |
| SMILES | CCCCNC(=O)C=CC1=Cc2cc(OC)c(OC)cc2CC1 |
| InChI | InChI=1S/C19H25NO3/c1-4-5-10-20-19(21)9-7-14-6-8-15-12-17(22-2)18(23-3)13-16(15)11-14/h7,9,11-13H,4-6,8,10H2,1-3H3,(H,20,21) |
| InChIKey | NTILYLYATHIFDT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|