C17H23NO3 — CID 102603138
1-(azepan-1-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 102603138) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(azepan-1-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102603138 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-(azepan-1-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)N2CCCCCC2)c(OC)c1 |
| InChI | InChI=1S/C17H23NO3/c1-20-15-9-7-14(16(13-15)21-2)8-10-17(19)18-11-5-3-4-6-12-18/h7-10,13H,3-6,11-12H2,1-2H3 |
| InChIKey | MVQVQKWQPUDQFN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|