C22H31NO6 — CID 77191338
tert-butyl [5-(2-methoxyethoxy)-2-(3-oxo-3-piperidin-1-ylprop-1-enyl)phenyl] carbonate (PubChem CID 77191338) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is tert-butyl [5-(2-methoxyethoxy)-2-(3-oxo-3-piperidin-1-ylprop-1-enyl)phenyl] carbonate.
| Compound Name | tert-butyl [5-(2-methoxyethoxy)-2-(3-oxo-3-piperidin-1-ylprop-1-enyl)phenyl] carbonate |
|---|---|
| PubChem CID | 77191338 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | tert-butyl [5-(2-methoxyethoxy)-2-(3-oxo-3-piperidin-1-ylprop-1-enyl)phenyl] carbonate |
| SMILES | COCCOc1ccc(C=CC(=O)N2CCCCC2)c(OC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H31NO6/c1-22(2,3)29-21(25)28-19-16-18(27-15-14-26-4)10-8-17(19)9-11-20(24)23-12-6-5-7-13-23/h8-11,16H,5-7,12-15H2,1-4H3 |
| InChIKey | UNIULJNRYDVAEA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|