C21H30O5 — CID 86617650
ethyl (E)-3-[2-(cyclohexylmethoxy)-4-(2-methoxyethoxy)phenyl]prop-2-enoate (PubChem CID 86617650) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethyl (E)-3-[2-(cyclohexylmethoxy)-4-(2-methoxyethoxy)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(cyclohexylmethoxy)-4-(2-methoxyethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86617650 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | ethyl (E)-3-[2-(cyclohexylmethoxy)-4-(2-methoxyethoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OCCOC)cc1OCC1CCCCC1 |
| InChI | InChI=1S/C21H30O5/c1-3-24-21(22)12-10-18-9-11-19(25-14-13-23-2)15-20(18)26-16-17-7-5-4-6-8-17/h9-12,15,17H,3-8,13-14,16H2,1-2H3/b12-10+ |
| InChIKey | RBNDJUJSOCDTBA-ZRDIBKRKSA-N |
| XLogP | 4.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|