C21H22Cl2O5 — CID 86617651
ethyl (E)-3-[2-[(2,4-dichlorophenyl)methoxy]-4-(2-methoxyethoxy)phenyl]prop-2-enoate (PubChem CID 86617651) has the molecular formula C21H22Cl2O5 and a molecular weight of 425.31 g/mol. Its IUPAC name is ethyl (E)-3-[2-[(2,4-dichlorophenyl)methoxy]-4-(2-methoxyethoxy)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[(2,4-dichlorophenyl)methoxy]-4-(2-methoxyethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86617651 |
| Molecular Formula | C21H22Cl2O5 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | ethyl (E)-3-[2-[(2,4-dichlorophenyl)methoxy]-4-(2-methoxyethoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OCCOC)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H22Cl2O5/c1-3-26-21(24)9-6-15-5-8-18(27-11-10-25-2)13-20(15)28-14-16-4-7-17(22)12-19(16)23/h4-9,12-13H,3,10-11,14H2,1-2H3/b9-6+ |
| InChIKey | WGKRJRUXVNFZPX-RMKNXTFCSA-N |
| XLogP | 5.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|