C18H16Cl2O3 — CID 91685540
ethyl (E)-3-[3-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 91685540) has the molecular formula C18H16Cl2O3 and a molecular weight of 351.23 g/mol. Its IUPAC name is ethyl (E)-3-[3-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91685540 |
| Molecular Formula | C18H16Cl2O3 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | ethyl (E)-3-[3-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H16Cl2O3/c1-2-22-18(21)9-6-13-4-3-5-16(10-13)23-12-14-7-8-15(19)11-17(14)20/h3-11H,2,12H2,1H3/b9-6+ |
| InChIKey | ILAJRKGJUGJSSG-RMKNXTFCSA-N |
| XLogP | 5.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|