C18H15Cl3O3 — CID 91684776
ethyl (E)-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 91684776) has the molecular formula C18H15Cl3O3 and a molecular weight of 385.67 g/mol. Its IUPAC name is ethyl (E)-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91684776 |
| Molecular Formula | C18H15Cl3O3 |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | ethyl (E)-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OCc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl3O3/c1-2-23-18(22)8-4-12-3-7-17(16(21)9-12)24-11-13-5-6-14(19)10-15(13)20/h3-10H,2,11H2,1H3/b8-4+ |
| InChIKey | IEIFXRLISGNNPL-XBXARRHUSA-N |
| XLogP | 5.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|