C26H23Cl2N3O4 — CID 76653390
ethyl 3-[4-[3-[2-(benzotriazol-2-yl)-4-chlorophenoxy]propoxy]-3-chlorophenyl]prop-2-enoate (PubChem CID 76653390) has the molecular formula C26H23Cl2N3O4 and a molecular weight of 512.39 g/mol. Its IUPAC name is ethyl 3-[4-[3-[2-(benzotriazol-2-yl)-4-chlorophenoxy]propoxy]-3-chlorophenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[3-[2-(benzotriazol-2-yl)-4-chlorophenoxy]propoxy]-3-chlorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76653390 |
| Molecular Formula | C26H23Cl2N3O4 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | ethyl 3-[4-[3-[2-(benzotriazol-2-yl)-4-chlorophenoxy]propoxy]-3-chlorophenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(OCCCOc2ccc(Cl)cc2-n2nc3ccccc3n2)c(Cl)c1 |
| InChI | InChI=1S/C26H23Cl2N3O4/c1-2-33-26(32)13-9-18-8-11-24(20(28)16-18)34-14-5-15-35-25-12-10-19(27)17-23(25)31-29-21-6-3-4-7-22(21)30-31/h3-4,6-13,16-17H,2,5,14-15H2,1H3 |
| InChIKey | DECAIRGHEOFSCT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|