C15H18F2O4 — CID 134093301
ethyl (E)-3-[3,4-bis(2-fluoroethoxy)phenyl]prop-2-enoate (PubChem CID 134093301) has the molecular formula C15H18F2O4 and a molecular weight of 300.30 g/mol. Its IUPAC name is ethyl (E)-3-[3,4-bis(2-fluoroethoxy)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3,4-bis(2-fluoroethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 134093301 |
| Molecular Formula | C15H18F2O4 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | ethyl (E)-3-[3,4-bis(2-fluoroethoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OCCF)c(OCCF)c1 |
| InChI | InChI=1S/C15H18F2O4/c1-2-19-15(18)6-4-12-3-5-13(20-9-7-16)14(11-12)21-10-8-17/h3-6,11H,2,7-10H2,1H3/b6-4+ |
| InChIKey | QXAOLFTURIRARO-GQCTYLIASA-N |
| XLogP | 2.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|