C20H22O4 — CID 732918
(4-methylphenyl) 3-(3,4-diethoxyphenyl)prop-2-enoate (PubChem CID 732918) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (4-methylphenyl) 3-(3,4-diethoxyphenyl)prop-2-enoate.
| Compound Name | (4-methylphenyl) 3-(3,4-diethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 732918 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (4-methylphenyl) 3-(3,4-diethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(C=CC(=O)Oc2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C20H22O4/c1-4-22-18-12-8-16(14-19(18)23-5-2)9-13-20(21)24-17-10-6-15(3)7-11-17/h6-14H,4-5H2,1-3H3 |
| InChIKey | PBJMLMNXIGKIMQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|