C23H28O4 — CID 2071669
(3,5-dimethylphenyl) (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate (PubChem CID 2071669) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (3,5-dimethylphenyl) (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate.
| Compound Name | (3,5-dimethylphenyl) (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2071669 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (3,5-dimethylphenyl) (E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)Oc2cc(C)cc(C)c2)cc1OCC |
| InChI | InChI=1S/C23H28O4/c1-5-7-12-26-21-10-8-19(16-22(21)25-6-2)9-11-23(24)27-20-14-17(3)13-18(4)15-20/h8-11,13-16H,5-7,12H2,1-4H3/b11-9+ |
| InChIKey | VTNXIVHKIZLQCU-PKNBQFBNSA-N |
| XLogP | 5.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|