C18H25NO5 — CID 69299982
ethyl 3-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate (PubChem CID 69299982) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethyl 3-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69299982 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | ethyl 3-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(OCCN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C18H25NO5/c1-3-23-18(20)7-5-15-4-6-16(17(14-15)21-2)24-13-10-19-8-11-22-12-9-19/h4-7,14H,3,8-13H2,1-2H3 |
| InChIKey | IYLBCDIQHRWYEW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|