C17H20N2O5 — CID 22687284
2-cyano-3-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoic acid (PubChem CID 22687284) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-cyano-3-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22687284 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-cyano-3-[3-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=C(C#N)C(=O)O)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C17H20N2O5/c1-22-16-11-13(10-14(12-18)17(20)21)2-3-15(16)24-9-6-19-4-7-23-8-5-19/h2-3,10-11H,4-9H2,1H3,(H,20,21) |
| InChIKey | JLKQTXDHYDJMLA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|