C33H44N2O7 — CID 127035896
(1E,4E)-1,5-bis[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]penta-1,4-dien-3-one (PubChem CID 127035896) has the molecular formula C33H44N2O7 and a molecular weight of 580.72 g/mol. Its IUPAC name is (1E,4E)-1,5-bis[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 127035896 |
| Molecular Formula | C33H44N2O7 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | (1E,4E)-1,5-bis[3-methoxy-4-(3-morpholin-4-ylpropoxy)phenyl]penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2ccc(OCCCN3CCOCC3)c(OC)c2)ccc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C33H44N2O7/c1-37-32-25-27(7-11-30(32)41-19-3-13-34-15-21-39-22-16-34)5-9-29(36)10-6-28-8-12-31(33(26-28)38-2)42-20-4-14-35-17-23-40-24-18-35/h5-12,25-26H,3-4,13-24H2,1-2H3/b9-5+,10-6+ |
| InChIKey | GGZHALCGOJLZJJ-NXZHAISVSA-N |
| XLogP | 4.20 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|