C28H34N2O6 — CID 153255337
(1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[4-(methylamino)-3-(3-morpholin-4-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 153255337) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[4-(methylamino)-3-(3-morpholin-4-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[4-(methylamino)-3-(3-morpholin-4-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 153255337 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-[4-(methylamino)-3-(3-morpholin-4-ylpropoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | CNc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C28H34N2O6/c1-29-25-10-6-21(18-27(25)36-15-3-12-30-13-16-35-17-14-30)4-8-23(31)20-24(32)9-5-22-7-11-26(33)28(19-22)34-2/h4-11,18-19,29,33H,3,12-17,20H2,1-2H3/b8-4+,9-5+ |
| InChIKey | WUDLTISJOWERDC-KBXRYBNXSA-N |
| XLogP | 3.80 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|