C26H30O6 — CID 46946665
(1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(3-methoxy-4-pentoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 46946665) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(3-methoxy-4-pentoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(3-methoxy-4-pentoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 46946665 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (1E,6E)-1-(4-hydroxy-3-methoxyphenyl)-7-(3-methoxy-4-pentoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | CCCCCOc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H30O6/c1-4-5-6-15-32-24-14-10-20(17-26(24)31-3)8-12-22(28)18-21(27)11-7-19-9-13-23(29)25(16-19)30-2/h7-14,16-17,29H,4-6,15,18H2,1-3H3/b11-7+,12-8+ |
| InChIKey | RFARZHKKCWNFBU-MKICQXMISA-N |
| XLogP | 5.23 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|